CAS 956434-30-3 is the registry number for tert–Butyl 8–chloro–2,3–dihydropyrido(3,2–f)(1,4)oxazepine–4(5H)–carboxylate. Offered by: GLPBio. Available pack sizes: 250mg.
Tert-butyl 8-chloro-3,5-dihydro-2H-pyrido[3,2-f][1,4]oxazepine-4-carboxylate (CAS 956434-30-3) is a chemical compound with the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. IUPAC name: tert-butyl 8-chloro-3,5-dihydro-2H-pyrido[3,2-f][1,4]oxazepine-4-carboxylate. InChIKey: RZCINNFEMKYQKK-UHFFFAOYSA-N.
| Molecular formula | C13H17ClN2O3 |
|---|---|
| Molecular weight | 284.74 g/mol |
| IUPAC name | tert-butyl 8-chloro-3,5-dihydro-2H-pyrido[3,2-f][1,4]oxazepine-4-carboxylate |
| InChIKey | RZCINNFEMKYQKK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOC2=C(C1)C=CC(=N2)Cl |
Computed by PubChem (NCBI)