Products 957127-83-2
CAS 957127-83-2 is the registry number for N-Boc-1h-indole-6-carboxylic acid methyl ester, 96%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
1-O-tert-butyl 6-O-methyl indole-1,6-dicarboxylate (CAS 957127-83-2) is a chemical compound with the molecular formula C15H17NO4 and a molecular weight of 275.30 g/mol. IUPAC name: 1-O-tert-butyl 6-O-methyl indole-1,6-dicarboxylate. InChIKey: IYYAAIGPQOLNLY-UHFFFAOYSA-N.
| Molecular formula | C15H17NO4 |
|---|---|
| Molecular weight | 275.30 g/mol |
| IUPAC name | 1-O-tert-butyl 6-O-methyl indole-1,6-dicarboxylate |
| InChIKey | IYYAAIGPQOLNLY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1C=CC2=C1C=C(C=C2)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
1-tert-Butyl 6-methyl 1H-indole-1,6-dicarboxylate, N-Boc-1H-Indole-6-carboxylic acid methyl ester, 1-O-tert-butyl 6-O-methyl indole-1,6-dicarboxylate, 1-tert-butyl 6-methyl indole-1,6-dicarboxylate, IYYAAIGPQOLNLY-UHFFFAOYSA-N, 1-tert-Butyl6-methylindoline-1,6-dicarboxylate, 1-tert-Butyl 6-methyl 1H-indole-16-dicarboxylate, O1-tert-butyl O6-methyl indole-1,6-dicarboxylate, 1-tert-Butyl-6-methyl 1H-indole-1,6-dicarboxylate, indole-1,6-dicarboxylic acid 1-tert-butyl ester 6-methyl ester