Products 958026-60-3
CAS 958026-60-3 is the registry number for tert-Butyl 3-(2-((methylsulfonyl)oxy)ethyl)azetidine-1-carboxylate, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 3-(2-methylsulfonyloxyethyl)azetidine-1-carboxylate (CAS 958026-60-3) is a chemical compound with the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl 3-(2-methylsulfonyloxyethyl)azetidine-1-carboxylate. InChIKey: JVIDYAXZPMXQIF-UHFFFAOYSA-N.
| Molecular formula | C11H21NO5S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl 3-(2-methylsulfonyloxyethyl)azetidine-1-carboxylate |
| InChIKey | JVIDYAXZPMXQIF-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)CCOS(=O)(=O)C |
Computed by PubChem (NCBI)