Products 95835-74-8

CAS 95835-74-8 appears in our catalog under these names: 5,6-Dimethyl-1-benzofuran-2-carboxylic acid, 95%, 5,6-Dimethyl-1-benzofuran-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,25g, 0,1g, 0,5g, 2g.

Structural formula: {0} (CAS {1})

5,6-dimethyl-1-benzofuran-2-carboxylic acid (CAS 95835-74-8) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 5,6-dimethyl-1-benzofuran-2-carboxylic acid. InChIKey: CLVJELFFCYDVPU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10O3
Molecular weight190.19 g/mol
IUPAC name5,6-dimethyl-1-benzofuran-2-carboxylic acid
InChIKeyCLVJELFFCYDVPU-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1C)OC(=C2)C(=O)O

Computed by PubChem (NCBI)