CAS 95835-74-8 appears in our catalog under these names: 5,6-Dimethyl-1-benzofuran-2-carboxylic acid, 95%, 5,6-Dimethyl-1-benzofuran-2-carboxylic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,25g, 0,1g, 0,5g, 2g.
5,6-dimethyl-1-benzofuran-2-carboxylic acid (CAS 95835-74-8) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 5,6-dimethyl-1-benzofuran-2-carboxylic acid. InChIKey: CLVJELFFCYDVPU-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 5,6-dimethyl-1-benzofuran-2-carboxylic acid |
| InChIKey | CLVJELFFCYDVPU-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)OC(=C2)C(=O)O |
Computed by PubChem (NCBI)