CAS 958832-56-9 is the registry number for 2-Bromo-1-chlorodibenzofuran, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
2-bromo-1-chlorodibenzofuran (CAS 958832-56-9) is a chemical compound with the molecular formula C12H6BrClO and a molecular weight of 281.53 g/mol. IUPAC name: 2-bromo-1-chlorodibenzofuran. InChIKey: QNOATYJSPILKHO-UHFFFAOYSA-N.
| Molecular formula | C12H6BrClO |
|---|---|
| Molecular weight | 281.53 g/mol |
| IUPAC name | 2-bromo-1-chlorodibenzofuran |
| InChIKey | QNOATYJSPILKHO-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=CC(=C3Cl)Br |
Computed by PubChem (NCBI)