Products 959236-78-3

CAS 959236-78-3 is the registry number for 1-[(benzyloxy)carbonyl]-4-methylpyrrolidine-3-carboxylic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

4-methyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid (CAS 959236-78-3) is a chemical compound with the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. IUPAC name: 4-methyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid. InChIKey: BBGSNKXBKDVHPM-UHFFFAOYSA-N.

Identity
Molecular formulaC14H17NO4
Molecular weight263.29 g/mol
IUPAC name4-methyl-1-phenylmethoxycarbonylpyrrolidine-3-carboxylic acid
InChIKeyBBGSNKXBKDVHPM-UHFFFAOYSA-N
SMILESCC1CN(CC1C(=O)O)C(=O)OCC2=CC=CC=C2

Computed by PubChem (NCBI)