Products 95980-02-2
CAS 95980-02-2 appears in our catalog under these names: 7-Methyl-2-phenylimidazo[1,2-a]pyrimidin-5-ol, 98%, 98%, 7-methyl-2-phenyl-5H,8H-imidazo[1,2-a]pyrimidin-5-one, 95+%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg.
7-methyl-2-phenyl-8H-imidazo[1,2-a]pyrimidin-5-one (CAS 95980-02-2) is a chemical compound with the molecular formula C13H11N3O and a molecular weight of 225.25 g/mol. IUPAC name: 7-methyl-2-phenyl-8H-imidazo[1,2-a]pyrimidin-5-one. InChIKey: HPELDCRCZHXSHN-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O |
|---|---|
| Molecular weight | 225.25 g/mol |
| IUPAC name | 7-methyl-2-phenyl-8H-imidazo[1,2-a]pyrimidin-5-one |
| InChIKey | HPELDCRCZHXSHN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=O)N2C=C(N=C2N1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)