Products 959987-48-5
CAS 959987-48-5 appears in our catalog under these names: 3-Methyl-5-nitro-4-((1-oxobutyl)amino) Benzoic Acid, 3-Methyl-5-nitro-4-((1-oxobutyl)amino)benzoic acid. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 1000mg, 500mg.
4-(butanoylamino)-3-methyl-5-nitrobenzoic acid (CAS 959987-48-5) is a chemical compound with the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. IUPAC name: 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid. InChIKey: DVRLOIAEMOQBBN-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O5 |
|---|---|
| Molecular weight | 266.25 g/mol |
| IUPAC name | 4-(butanoylamino)-3-methyl-5-nitrobenzoic acid |
| InChIKey | DVRLOIAEMOQBBN-UHFFFAOYSA-N |
| SMILES | CCCC(=O)NC1=C(C=C(C=C1C)C(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)