CAS 960324-76-9 appears in our catalog under these names: 4-Methanesulfonamido-2-methylbenzoic acid, 95%, 4-Methanesulfonamido-2-methylbenzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(methanesulfonamido)-2-methylbenzoic acid (CAS 960324-76-9) is a chemical compound with the molecular formula C9H11NO4S and a molecular weight of 229.26 g/mol. IUPAC name: 4-(methanesulfonamido)-2-methylbenzoic acid. InChIKey: AQMPSJKNYOITCR-UHFFFAOYSA-N.
| Molecular formula | C9H11NO4S |
|---|---|
| Molecular weight | 229.26 g/mol |
| IUPAC name | 4-(methanesulfonamido)-2-methylbenzoic acid |
| InChIKey | AQMPSJKNYOITCR-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)NS(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)