Products 96129-66-7
CAS 96129-66-7 appears in our catalog under these names: Methyl 2-(2,5-dichlorophenyl)acetate, 95%, Methyl 2-(2,5-dichlorophenyl)acetate, Methyl 2-(2,5-Dichlorophenyl)acetate, 98%, 98%, METHYL 2-(2,5-DICHLOROPHENYL)ACETATE, 98%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 2,5g, 250mg, 100mg, 5g.
Methyl 2-(2,5-dichlorophenyl)acetate (CAS 96129-66-7) is a chemical compound with the molecular formula C9H8Cl2O2 and a molecular weight of 219.06 g/mol. IUPAC name: methyl 2-(2,5-dichlorophenyl)acetate. InChIKey: VOIWSHPZFSPALW-UHFFFAOYSA-N.
| Molecular formula | C9H8Cl2O2 |
|---|---|
| Molecular weight | 219.06 g/mol |
| IUPAC name | methyl 2-(2,5-dichlorophenyl)acetate |
| InChIKey | VOIWSHPZFSPALW-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=CC(=C1)Cl)Cl |
Computed by PubChem (NCBI)