Products 96259-02-8
CAS 96259-02-8 appears in our catalog under these names: DL-3-Phenylalanine-d2, DL-phenylalanine-beta,beta-D2, 98 atom. Offered by: MedChemExpress, Sigma-Aldrich. Available pack sizes: Get quote, 500MG.
2-amino-3,3-dideuterio-3-phenylpropanoic acid (CAS 96259-02-8) is a chemical compound with the molecular formula C9H11NO2 and a molecular weight of 167.20 g/mol. IUPAC name: 2-amino-3,3-dideuterio-3-phenylpropanoic acid. InChIKey: COLNVLDHVKWLRT-NCYHJHSESA-N.
| Molecular formula | C9H11NO2 |
|---|---|
| Molecular weight | 167.20 g/mol |
| IUPAC name | 2-amino-3,3-dideuterio-3-phenylpropanoic acid |
| InChIKey | COLNVLDHVKWLRT-NCYHJHSESA-N |
| SMILES | [2H]C([2H])(C1=CC=CC=C1)C(C(=O)O)N |
Computed by PubChem (NCBI)