CAS 96291-74-6 is the registry number for 1,3,5-Tri-O-acetyl-2-deoxy-a-D-ribofuranose. Offered by: Biosynth. Available pack sizes: 1g.
[(2R,3S,5R)-3,5-diacetyloxyoxolan-2-yl]methyl acetate (CAS 96291-74-6) is a chemical compound with the molecular formula C11H16O7 and a molecular weight of 260.24 g/mol. IUPAC name: [(2R,3S,5R)-3,5-diacetyloxyoxolan-2-yl]methyl acetate. InChIKey: QAGMBTAACMQRSS-AXFHLTTASA-N.
| Molecular formula | C11H16O7 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | [(2R,3S,5R)-3,5-diacetyloxyoxolan-2-yl]methyl acetate |
| InChIKey | QAGMBTAACMQRSS-AXFHLTTASA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H](C[C@H](O1)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)