CAS 96356-16-0 appears in our catalog under these names: 2,6-Dimethylimidazo(2,1-b)(1,3,4)thiadiazole-5-carboxylic acid, 95%, Dimethylimidazo(2,1-b)(1,3,4)thiadiazole-5-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazole-5-carboxylic acid (CAS 96356-16-0) is a chemical compound with the molecular formula C7H7N3O2S and a molecular weight of 197.22 g/mol. IUPAC name: 2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazole-5-carboxylic acid. InChIKey: UDLNUIGAQRAOOK-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O2S |
|---|---|
| Molecular weight | 197.22 g/mol |
| IUPAC name | 2,6-dimethylimidazo[2,1-b][1,3,4]thiadiazole-5-carboxylic acid |
| InChIKey | UDLNUIGAQRAOOK-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=N1)SC(=N2)C)C(=O)O |
Computed by PubChem (NCBI)