CAS 66866-68-0 appears in our catalog under these names: N-Methyl-l-isoleucine hydrochloride, 95%, (2S,3S)-3-Methyl-2-(methylamino)pentanoic acid hydrochloride, 98%, 98%, (2S,3S)-3-Methyl-2-(methylamino)pentanoic acid hydrochloride, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 25g, 5g, 100mg, 250mg, 500mg.
(2S,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride (CAS 66866-68-0) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (2S,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride. InChIKey: MMBGZHHBWVCZFK-GEMLJDPKSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (2S,3S)-3-methyl-2-(methylamino)pentanoic acid;hydrochloride |
| InChIKey | MMBGZHHBWVCZFK-GEMLJDPKSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)NC.Cl |
Computed by PubChem (NCBI)