Products 1330286-49-1
CAS 1330286-49-1 appears in our catalog under these names: H-HoLeu-OH hydrochloride, 95%, L-Homoleucine hydrochloride, H-HoLeu-OH·HCl 98%, H-HoLeu-OH HCl, 98%, 98%, (S)-2-Amino-5-methylhexanoic acid hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 500mg, 1000mg.
(2S)-2-amino-5-methylhexanoic acid;hydrochloride (CAS 1330286-49-1) is a chemical compound with the molecular formula C7H16ClNO2 and a molecular weight of 181.66 g/mol. IUPAC name: (2S)-2-amino-5-methylhexanoic acid;hydrochloride. InChIKey: FQKANUHWZITUKA-RGMNGODLSA-N.
| Molecular formula | C7H16ClNO2 |
|---|---|
| Molecular weight | 181.66 g/mol |
| IUPAC name | (2S)-2-amino-5-methylhexanoic acid;hydrochloride |
| InChIKey | FQKANUHWZITUKA-RGMNGODLSA-N |
| SMILES | CC(C)CC[C@@H](C(=O)O)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
H-HOLEU-OH HCL, H-Holeu-OH hydrochloride, (S)-2-Amino-5-methylhexanoic acid hydrochloride, (2S)-2-amino-5-methylhexanoic acid;hydrochloride, H-HoLeu-OH (hydrochloride), L-Homoleucine Hydrochloride, H-HoLeu-OH(hydrochloride), L-HomoLeu-OH hydrochloride, (S)-2-Amino-5-methylhexanoic Acid HCl, (S)-2-Amino-5-methylhexanoicacidhydrochloride