Products 96483-83-9
CAS 96483-83-9 is the registry number for 3-Benzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
3-benzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione (CAS 96483-83-9) is a chemical compound with the molecular formula C13H14N2O2 and a molecular weight of 230.26 g/mol. IUPAC name: 3-benzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione. InChIKey: NTNUTDMPEVEYBJ-UHFFFAOYSA-N.
| Molecular formula | C13H14N2O2 |
|---|---|
| Molecular weight | 230.26 g/mol |
| IUPAC name | 3-benzyl-3,8-diazabicyclo[3.2.1]octane-2,4-dione |
| InChIKey | NTNUTDMPEVEYBJ-UHFFFAOYSA-N |
| SMILES | C1CC2C(=O)N(C(=O)C1N2)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)