CAS 96605-61-7 appears in our catalog under these names: N-(3-(3-Dimethylaminoacryloyl)phenyl)acetamide, N-{3-[(2E)-3-(dimethylamino)prop-2-enoyl]phenyl}acetamide. Offered by: TRC, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg, 250mg, 1g, 5g.
N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]acetamide (CAS 96605-61-7) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]acetamide. InChIKey: AIWCFDGABJPHDI-BQYQJAHWSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | N-[3-[(E)-3-(dimethylamino)prop-2-enoyl]phenyl]acetamide |
| InChIKey | AIWCFDGABJPHDI-BQYQJAHWSA-N |
| SMILES | CC(=O)NC1=CC=CC(=C1)C(=O)/C=C/N(C)C |
Computed by PubChem (NCBI)