Products 96681-85-5
CAS 96681-85-5 appears in our catalog under these names: Potassium Clavulanate EP Impurity B, Clavulanate Potassium Impurity B, 3-(3,6-Bis(2-hydroxyethyl)pyrazin-2-yl)propanoic acid, 95+%, 3-(3,6-Bis(2-hydroxyethyl)pyrazin-2-yl)propanoic acid, 97%, 97%, Potassium Clavulanate EP Impurity B Sodium Salt. Offered by: Chemat Brand, AmBeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g, 50mg, 10mg, 25mg.
3-[3,6-bis(2-hydroxyethyl)pyrazin-2-yl]propanoic acid (CAS 96681-85-5) is a chemical compound with the molecular formula C11H16N2O4 and a molecular weight of 240.26 g/mol. IUPAC name: 3-[3,6-bis(2-hydroxyethyl)pyrazin-2-yl]propanoic acid. InChIKey: LOAQLPWVJYSQKH-UHFFFAOYSA-N.
| Molecular formula | C11H16N2O4 |
|---|---|
| Molecular weight | 240.26 g/mol |
| IUPAC name | 3-[3,6-bis(2-hydroxyethyl)pyrazin-2-yl]propanoic acid |
| InChIKey | LOAQLPWVJYSQKH-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(C(=N1)CCO)CCC(=O)O)CCO |
Computed by PubChem (NCBI)