Products 96807-75-9
CAS 96807-75-9 is the registry number for 3-{2-((2-Hydroxyethyl)amino)ethyl}-3-azatricyclo(7.3.1.0,5,13)trideca-1(13),5,7,9,11-pentaene-2,4-dione. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[2-(2-hydroxyethylamino)ethyl]benzo[de]isoquinoline-1,3-dione (CAS 96807-75-9) is a chemical compound with the molecular formula C16H16N2O3 and a molecular weight of 284.31 g/mol. IUPAC name: 2-[2-(2-hydroxyethylamino)ethyl]benzo[de]isoquinoline-1,3-dione. InChIKey: URSGUHDKQBISNA-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O3 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | 2-[2-(2-hydroxyethylamino)ethyl]benzo[de]isoquinoline-1,3-dione |
| InChIKey | URSGUHDKQBISNA-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(=O)N(C(=O)C3=CC=C2)CCNCCO |
Computed by PubChem (NCBI)