CAS 97095-26-6 is the registry number for 1-((4-methylphenyl)carbonyl)indoline-2,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
1-(4-methylbenzoyl)indole-2,3-dione (CAS 97095-26-6) is a chemical compound with the molecular formula C16H11NO3 and a molecular weight of 265.26 g/mol. IUPAC name: 1-(4-methylbenzoyl)indole-2,3-dione. InChIKey: WHKHHONXPFVZFV-UHFFFAOYSA-N.
| Molecular formula | C16H11NO3 |
|---|---|
| Molecular weight | 265.26 g/mol |
| IUPAC name | 1-(4-methylbenzoyl)indole-2,3-dione |
| InChIKey | WHKHHONXPFVZFV-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)N2C3=CC=CC=C3C(=O)C2=O |
Computed by PubChem (NCBI)