CAS 97209-05-7 is the registry number for 4-Chloro-3-ethoxybenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
4-chloro-3-ethoxybenzoic acid (CAS 97209-05-7) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 4-chloro-3-ethoxybenzoic acid. InChIKey: DVZTYMNTUWPGIO-UHFFFAOYSA-N.
| Molecular formula | C9H9ClO3 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | 4-chloro-3-ethoxybenzoic acid |
| InChIKey | DVZTYMNTUWPGIO-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C(=O)O)Cl |
Computed by PubChem (NCBI)