Products 97209-05-7

CAS 97209-05-7 is the registry number for 4-Chloro-3-ethoxybenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-chloro-3-ethoxybenzoic acid (CAS 97209-05-7) is a chemical compound with the molecular formula C9H9ClO3 and a molecular weight of 200.62 g/mol. IUPAC name: 4-chloro-3-ethoxybenzoic acid. InChIKey: DVZTYMNTUWPGIO-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9ClO3
Molecular weight200.62 g/mol
IUPAC name4-chloro-3-ethoxybenzoic acid
InChIKeyDVZTYMNTUWPGIO-UHFFFAOYSA-N
SMILESCCOC1=C(C=CC(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)