CAS 98054-68-3 appears in our catalog under these names: 3-(4-Fluorophenyl)-3-methylpyrrolidine-2,5-dione, 3-(4-Fluorophenyl)-3-methylpyrrolidine-2,5-dione, 98%. Offered by: Biosynth, AmBeed. Available pack sizes: 50mg, 0,5g, 5g.
3-(4-fluorophenyl)-3-methylpyrrolidine-2,5-dione (CAS 98054-68-3) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: 3-(4-fluorophenyl)-3-methylpyrrolidine-2,5-dione. InChIKey: OUTUPNINQIXCJZ-UHFFFAOYSA-N.
| Molecular formula | C11H10FNO2 |
|---|---|
| Molecular weight | 207.20 g/mol |
| IUPAC name | 3-(4-fluorophenyl)-3-methylpyrrolidine-2,5-dione |
| InChIKey | OUTUPNINQIXCJZ-UHFFFAOYSA-N |
| SMILES | CC1(CC(=O)NC1=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)