Products 98279-84-6
CAS 98279-84-6 is the registry number for 1-(2-Hydroxyethyl)-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carbonitrile. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(2-hydroxyethyl)-2,4-dioxopyrimidine-5-carbonitrile (CAS 98279-84-6) is a chemical compound with the molecular formula C7H7N3O3 and a molecular weight of 181.15 g/mol. IUPAC name: 1-(2-hydroxyethyl)-2,4-dioxopyrimidine-5-carbonitrile. InChIKey: BDWWKLPBKZASIC-UHFFFAOYSA-N.
| Molecular formula | C7H7N3O3 |
|---|---|
| Molecular weight | 181.15 g/mol |
| IUPAC name | 1-(2-hydroxyethyl)-2,4-dioxopyrimidine-5-carbonitrile |
| InChIKey | BDWWKLPBKZASIC-UHFFFAOYSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1CCO)C#N |
Computed by PubChem (NCBI)