CAS 98410-68-5 appears in our catalog under these names: 3,5-Dimethoxy-2-naphthoic acid, 95%, 3,5-Dimethoxy-2-naphthoic acid, 95+%. Offered by: Combi-blocks, Chemat Brand. Available pack sizes: 500mg, on request.
3,5-dimethoxynaphthalene-2-carboxylic acid (CAS 98410-68-5) is a chemical compound with the molecular formula C13H12O4 and a molecular weight of 232.23 g/mol. IUPAC name: 3,5-dimethoxynaphthalene-2-carboxylic acid. InChIKey: VTPNSKNCVKIPIX-UHFFFAOYSA-N.
| Molecular formula | C13H12O4 |
|---|---|
| Molecular weight | 232.23 g/mol |
| IUPAC name | 3,5-dimethoxynaphthalene-2-carboxylic acid |
| InChIKey | VTPNSKNCVKIPIX-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=CC(=C(C=C21)OC)C(=O)O |
Computed by PubChem (NCBI)