CAS 98434-18-5 appears in our catalog under these names: 2-Bromo-4-chlorophenyl acetate, 95%, 2-Bromo-4-chlorophenyl acetate, 97%, 97%, 2-Bromo-4-chlorophenyl acetate, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
(2-bromo-4-chlorophenyl) acetate (CAS 98434-18-5) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: (2-bromo-4-chlorophenyl) acetate. InChIKey: ZJIVOTRCIJQFNJ-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | (2-bromo-4-chlorophenyl) acetate |
| InChIKey | ZJIVOTRCIJQFNJ-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=C(C=C1)Cl)Br |
Computed by PubChem (NCBI)