Products 98997-45-6
CAS 98997-45-6 is the registry number for Ethyl 2-((5-nitropyridin-2-yl)amino)acetate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Ethyl 2-[(5-nitro-2-pyridinyl)amino]acetate (CAS 98997-45-6) is a chemical compound with the molecular formula C9H11N3O4 and a molecular weight of 225.20 g/mol. IUPAC name: ethyl 2-[(5-nitro-2-pyridinyl)amino]acetate. InChIKey: JHRJMJQDEVTQBG-UHFFFAOYSA-N.
| Molecular formula | C9H11N3O4 |
|---|---|
| Molecular weight | 225.20 g/mol |
| IUPAC name | ethyl 2-[(5-nitro-2-pyridinyl)amino]acetate |
| InChIKey | JHRJMJQDEVTQBG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CNC1=NC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)