Products 99055-49-9
CAS 99055-49-9 appears in our catalog under these names: 6-Amino-3-methyl-3,4-dihydro-1,2,3-benzotriazin-4-one, 95%, 6-Amino-3-methyl-3,4-dihydro-1,2,3-benzotriazin-4-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 5g.
6-amino-3-methyl-1,2,3-benzotriazin-4-one (CAS 99055-49-9) is a chemical compound with the molecular formula C8H8N4O and a molecular weight of 176.18 g/mol. IUPAC name: 6-amino-3-methyl-1,2,3-benzotriazin-4-one. InChIKey: VMEJBRIZBKOVPM-UHFFFAOYSA-N.
| Molecular formula | C8H8N4O |
|---|---|
| Molecular weight | 176.18 g/mol |
| IUPAC name | 6-amino-3-methyl-1,2,3-benzotriazin-4-one |
| InChIKey | VMEJBRIZBKOVPM-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=C(C=CC(=C2)N)N=N1 |
Computed by PubChem (NCBI)