CAS 99357-41-2 appears in our catalog under these names: 4-(Dimethylamino)-2,5-difluorobenzaldehyde, 98%, 4-(Dimethylamino)-2,5-difluorobenzaldehyde. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 100mg, 1g.
4-(dimethylamino)-2,5-difluorobenzaldehyde (CAS 99357-41-2) is a chemical compound with the molecular formula C9H9F2NO and a molecular weight of 185.17 g/mol. IUPAC name: 4-(dimethylamino)-2,5-difluorobenzaldehyde. InChIKey: LYZXAPALPIXQRZ-UHFFFAOYSA-N.
| Molecular formula | C9H9F2NO |
|---|---|
| Molecular weight | 185.17 g/mol |
| IUPAC name | 4-(dimethylamino)-2,5-difluorobenzaldehyde |
| InChIKey | LYZXAPALPIXQRZ-UHFFFAOYSA-N |
| SMILES | CN(C)C1=C(C=C(C(=C1)F)C=O)F |
Computed by PubChem (NCBI)