Products 99446-39-6
CAS 99446-39-6 is the registry number for 6,7-Dimethylpyrazolo(1,5-a)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid (CAS 99446-39-6) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid. InChIKey: KYNPCXXMNPNXSS-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 6,7-dimethylpyrazolo[1,5-a]pyridine-3-carboxylic acid |
| InChIKey | KYNPCXXMNPNXSS-UHFFFAOYSA-N |
| SMILES | CC1=C(N2C(=C(C=N2)C(=O)O)C=C1)C |
Computed by PubChem (NCBI)