CAS 99595-73-0 appears in our catalog under these names: 1-(4-Aminophenyl)-4,5-dihydro-1H-1,2,3,4-tetrazol-5-one, 95%, 1-(4-Aminophenyl)-4,5-dihydro-1H-1,2,3,4-tetrazol-5-one, 1-(4-Aminophenyl)-4,5-dihydro-1H-1,2,3,4-tetrazol-5-one, 95%, 95%. Offered by: AmBeed, Biosynth, Chemat. Available pack sizes: 1g, 50mg, 0,5g, 100mg.
4-(4-aminophenyl)-1H-tetrazol-5-one (CAS 99595-73-0) is a chemical compound with the molecular formula C7H7N5O and a molecular weight of 177.16 g/mol. IUPAC name: 4-(4-aminophenyl)-1H-tetrazol-5-one. InChIKey: OKAOEKKGMDHTRG-UHFFFAOYSA-N.
| Molecular formula | C7H7N5O |
|---|---|
| Molecular weight | 177.16 g/mol |
| IUPAC name | 4-(4-aminophenyl)-1H-tetrazol-5-one |
| InChIKey | OKAOEKKGMDHTRG-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)N2C(=O)NN=N2 |
Computed by PubChem (NCBI)