CAS 99665-70-0 is the registry number for Ethyl 5-hydroxy-2-iodobenzoate, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
Ethyl 5-hydroxy-2-iodobenzoate (CAS 99665-70-0) is a chemical compound with the molecular formula C9H9IO3 and a molecular weight of 292.07 g/mol. IUPAC name: ethyl 5-hydroxy-2-iodobenzoate. InChIKey: BXQKOHCATJNBOZ-UHFFFAOYSA-N.
| Molecular formula | C9H9IO3 |
|---|---|
| Molecular weight | 292.07 g/mol |
| IUPAC name | ethyl 5-hydroxy-2-iodobenzoate |
| InChIKey | BXQKOHCATJNBOZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)O)I |
Computed by PubChem (NCBI)