Products 99865-71-1

CAS 99865-71-1 is the registry number for Ferulic Acid Impurity 10. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(4-hydroxy-3-methoxyphenyl)-2-methylprop-2-enoic acid (CAS 99865-71-1) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: 3-(4-hydroxy-3-methoxyphenyl)-2-methylprop-2-enoic acid. InChIKey: YHOAZFMXZXWRHC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H12O4
Molecular weight208.21 g/mol
IUPAC name3-(4-hydroxy-3-methoxyphenyl)-2-methylprop-2-enoic acid
InChIKeyYHOAZFMXZXWRHC-UHFFFAOYSA-N
SMILESCC(=CC1=CC(=C(C=C1)O)OC)C(=O)O

Computed by PubChem (NCBI)