CAS 99924-18-2 appears in our catalog under these names: 5–Phenyloxazole–4–carboxylic Acid, 5-Phenyl-1,3-oxazole-4-carboxylic acid, 97% , 5-Phenyloxazole-4-carboxylic acid 97%, 5-Phenyloxazole-4-carboxylic Acid, 98%, 98%, 5-Phenyl-1,3-oxazole-4-carboxylic acid, 98%. Offered by: GLPBio, Thermo Scientific, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g, 100mg.
5-phenyl-1,3-oxazole-4-carboxylic acid (CAS 99924-18-2) is a chemical compound with the molecular formula C10H7NO3 and a molecular weight of 189.17 g/mol. IUPAC name: 5-phenyl-1,3-oxazole-4-carboxylic acid. InChIKey: RUKDIKJSGDVSIF-UHFFFAOYSA-N.
| Molecular formula | C10H7NO3 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | 5-phenyl-1,3-oxazole-4-carboxylic acid |
| InChIKey | RUKDIKJSGDVSIF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=CO2)C(=O)O |
Computed by PubChem (NCBI)