Products 120013-84-5
CAS 120013-84-5 appears in our catalog under these names: Donepezil N–oxide, Donepezil-n-oxide, 95%, Donepezil N-Oxide, rac-(cis/trans) Donepezil N-Oxide, >95% (HPLC), rac-(cis/trans) Donepezil N-oxide. Offered by: GLPBio, Combi-blocks, Chemat Brand, Mikromol, TRC. Available pack sizes: 5mg, 100mg, on request, 25mg, 10mg, 50mg, 1mg, 500ug.
2-[(1-benzyl-1-oxidopiperidin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one (CAS 120013-84-5) is a chemical compound with the molecular formula C24H29NO4 and a molecular weight of 395.5 g/mol. IUPAC name: 2-[(1-benzyl-1-oxidopiperidin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one. InChIKey: XRPRYHONRUINMG-UHFFFAOYSA-N.
| Molecular formula | C24H29NO4 |
|---|---|
| Molecular weight | 395.5 g/mol |
| IUPAC name | 2-[(1-benzyl-1-oxidopiperidin-1-ium-4-yl)methyl]-5,6-dimethoxy-2,3-dihydroinden-1-one |
| InChIKey | XRPRYHONRUINMG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)CC(C2=O)CC3CC[N+](CC3)(CC4=CC=CC=C4)[O-])OC |
Computed by PubChem (NCBI)