cas: 67885-97-6 — see every product listed under this CAS number, including other names
rel-(1R,2R)-4-Oxo-1,2-cyclopentanedicarboxylic acid, 98%, 98% (CAS 67885-97-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FF9C-100mg |
| cas | 67885-97-6 |
| size | 100mg |
| availability | 200g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 333.20 Pln | |
| Chemat | 5g | 750.80 Pln | |
| Chemat | 10g | 1096.40 Pln | |
| Chemat | 25g | 1782.80 Pln | |
| Chemat | 50g | 2819.60 Pln | |
| Chemat | 100g | 4197.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2R)-4-oxocyclopentane-1,2-dicarboxylic acid (CAS 67885-97-6) is a chemical compound with the molecular formula C7H8O5 and a molecular weight of 172.13 g/mol. IUPAC name: trans-(1R,2R)-4-oxocyclopentane-1,2-dicarboxylic acid. InChIKey: CJSMOECOKYPHSC-RFZPGFLSSA-N.
| Molecular formula | C7H8O5 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | trans-(1R,2R)-4-oxocyclopentane-1,2-dicarboxylic acid |
| InChIKey | CJSMOECOKYPHSC-RFZPGFLSSA-N |
| SMILES | C1[C@H]([C@@H](CC1=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)