cas: 1341035-02-6 — see every product listed under this CAS number, including other names
rel-(1R,2S)-2'-Oxospiro(cyclopropane-1,3'-indoline)-2-carboxylic acid, 98% (CAS 1341035-02-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A984253-250mg |
| cas | 1341035-02-6 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 5994.10 Pln | |
| AmBeed | 1g | 9971.71 Pln | |
| AmBeed | 5g | 34768.30 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(1'S,3R)-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylic acid (CAS 1341035-02-6) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: (1'S,3R)-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylic acid. InChIKey: WQBMGVVIMKVWJT-HQJQHLMTSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | (1'S,3R)-2-oxospiro[1H-indole-3,2'-cyclopropane]-1'-carboxylic acid |
| InChIKey | WQBMGVVIMKVWJT-HQJQHLMTSA-N |
| SMILES | C1[C@@H]([C@@]12C3=CC=CC=C3NC2=O)C(=O)O |
Computed by PubChem (NCBI)