cas: 2173637-08-4 — see every product listed under this CAS number, including other names
tert-Butyl ((2R,3S)-2-methylazetidin-3-yl)carbamate hydrochloride 95% (CAS 2173637-08-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A2865911-100mg |
| cas | 2173637-08-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 759.75 Pln | |
| Ambeed | 250mg | 1171.38 Pln | |
| Ambeed | 1g | 2823.44 Pln | |
| Ambeed | 5g | 6956.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A2865911 |
Tert-butyl N-[(2R,3S)-2-methylazetidin-3-yl]carbamate;hydrochloride (CAS 2173637-08-4) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-[(2R,3S)-2-methylazetidin-3-yl]carbamate;hydrochloride. InChIKey: QEGLJGQQFDDFJO-HHQFNNIRSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl N-[(2R,3S)-2-methylazetidin-3-yl]carbamate;hydrochloride |
| InChIKey | QEGLJGQQFDDFJO-HHQFNNIRSA-N |
| SMILES | C[C@@H]1[C@H](CN1)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)