cas: 2173637-08-4 — see every product listed under this CAS number, including other names
tert-butyl ((2R,3S)-2-methylazetidin-3-yl)carbamate hydrochloride, 95%, 95% (CAS 2173637-08-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg, 500mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IKXT-1g |
| cas | 2173637-08-4 |
| size | 1g |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2104.40 Pln | |
| Chemat | 5g | 6189.20 Pln | |
| Chemat | 10g | 11944.40 Pln | |
| Chemat | 100mg | 630.80 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 500mg | 1456.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-[(2R,3S)-2-methylazetidin-3-yl]carbamate;hydrochloride (CAS 2173637-08-4) is a chemical compound with the molecular formula C9H19ClN2O2 and a molecular weight of 222.71 g/mol. IUPAC name: tert-butyl N-[(2R,3S)-2-methylazetidin-3-yl]carbamate;hydrochloride. InChIKey: QEGLJGQQFDDFJO-HHQFNNIRSA-N.
| Molecular formula | C9H19ClN2O2 |
|---|---|
| Molecular weight | 222.71 g/mol |
| IUPAC name | tert-butyl N-[(2R,3S)-2-methylazetidin-3-yl]carbamate;hydrochloride |
| InChIKey | QEGLJGQQFDDFJO-HHQFNNIRSA-N |
| SMILES | C[C@@H]1[C@H](CN1)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)