cas: 1049727-98-1 — see every product listed under this CAS number, including other names
tert-Butyl (piperidin-4-ylmethyl)carbamate hydrochloride, 95%, 95% (CAS 1049727-98-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118FZD-250mg |
| cas | 1049727-98-1 |
| size | 250mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 242.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(piperidin-4-ylmethyl)carbamate;hydrochloride (CAS 1049727-98-1) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl N-(piperidin-4-ylmethyl)carbamate;hydrochloride. InChIKey: YAFYUSHKQUUFGI-UHFFFAOYSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl N-(piperidin-4-ylmethyl)carbamate;hydrochloride |
| InChIKey | YAFYUSHKQUUFGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCNCC1.Cl |
Computed by PubChem (NCBI)