cas: 1049727-98-1 — see every product listed under this CAS number, including other names
tert-Butyl (piperidin-4-ylmethyl)carbamate hydrochloride, 95% (CAS 1049727-98-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A672316-1g |
| cas | 1049727-98-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 486.64 Pln | |
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 440.49 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl N-(piperidin-4-ylmethyl)carbamate;hydrochloride (CAS 1049727-98-1) is a chemical compound with the molecular formula C11H23ClN2O2 and a molecular weight of 250.76 g/mol. IUPAC name: tert-butyl N-(piperidin-4-ylmethyl)carbamate;hydrochloride. InChIKey: YAFYUSHKQUUFGI-UHFFFAOYSA-N.
| Molecular formula | C11H23ClN2O2 |
|---|---|
| Molecular weight | 250.76 g/mol |
| IUPAC name | tert-butyl N-(piperidin-4-ylmethyl)carbamate;hydrochloride |
| InChIKey | YAFYUSHKQUUFGI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1CCNCC1.Cl |
Computed by PubChem (NCBI)