cas: 851325-42-3 — see every product listed under this CAS number, including other names
tert-Butyl 2,8-diazaspiro[4.5]decane-8-carboxylate HCl 97% (CAS 851325-42-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A163547-100mg |
| cas | 851325-42-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 442.69 Pln | |
| Ambeed | 250mg | 598.44 Pln | |
| Ambeed | 1g | 787.56 Pln | |
| Ambeed | 5g | 2678.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A163547 |
Tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride (CAS 851325-42-3) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride. InChIKey: WZWUCNJUMVSAJD-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride |
| InChIKey | WZWUCNJUMVSAJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC2)CC1.Cl |
Computed by PubChem (NCBI)