cas: 851325-42-3 — see every product listed under this CAS number, including other names
tert-Butyl 2,8-diazaspiro[4.5]decane-8-carboxylate hydrochloride, 97%, 97% (CAS 851325-42-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G816-50mg |
| cas | 851325-42-3 |
| size | 50mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 198.80 Pln | |
| Chemat | 100mg | 285.20 Pln | |
| Chemat | 250mg | 534.80 Pln | |
| Chemat | 1g | 741.20 Pln | |
| Chemat | 5g | 2838.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride (CAS 851325-42-3) is a chemical compound with the molecular formula C13H25ClN2O2 and a molecular weight of 276.80 g/mol. IUPAC name: tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride. InChIKey: WZWUCNJUMVSAJD-UHFFFAOYSA-N.
| Molecular formula | C13H25ClN2O2 |
|---|---|
| Molecular weight | 276.80 g/mol |
| IUPAC name | tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;hydrochloride |
| InChIKey | WZWUCNJUMVSAJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCNC2)CC1.Cl |
Computed by PubChem (NCBI)