cas: 1263281-14-6 — see every product listed under this CAS number, including other names
tert-Butyl 2-bromo-5-fluorobenzoate 95% (CAS 1263281-14-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A110108-250mg |
| cas | 1263281-14-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 337.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A110108 |
Tert-butyl 2-bromo-5-fluorobenzoate (CAS 1263281-14-6) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 2-bromo-5-fluorobenzoate. InChIKey: YTPNUWRXGPLOBX-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 2-bromo-5-fluorobenzoate |
| InChIKey | YTPNUWRXGPLOBX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)F)Br |
Computed by PubChem (NCBI)