cas: 375368-94-8 — see every product listed under this CAS number, including other names
tert-Butyl 3-bromo-4-fluorobenzoate, 97% (CAS 375368-94-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F689858-100MG |
| cas | 375368-94-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 154.13 Pln | |
| Fluorochem | 250mg | 221.81 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1200.64 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Tert-butyl 3-bromo-4-fluorobenzoate (CAS 375368-94-8) is a chemical compound with the molecular formula C11H12BrFO2 and a molecular weight of 275.11 g/mol. IUPAC name: tert-butyl 3-bromo-4-fluorobenzoate. InChIKey: MUGCZCJMBJFCIX-UHFFFAOYSA-N.
| Molecular formula | C11H12BrFO2 |
|---|---|
| Molecular weight | 275.11 g/mol |
| IUPAC name | tert-butyl 3-bromo-4-fluorobenzoate |
| InChIKey | MUGCZCJMBJFCIX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC(=C(C=C1)F)Br |
Computed by PubChem (NCBI)