cas: 885272-46-8 — see every product listed under this CAS number, including other names
tert-Butyl 4-bromoindoline-1-carboxylate 97% (CAS 885272-46-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A131483-250mg |
| cas | 885272-46-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 826.50 Pln | |
| Ambeed | 10g | 1571.88 Pln | |
| Ambeed | 25g | 3073.75 Pln | |
| Ambeed | 100g | 9693.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A131483 |
Tert-butyl 4-bromo-2,3-dihydroindole-1-carboxylate (CAS 885272-46-8) is a chemical compound with the molecular formula C13H16BrNO2 and a molecular weight of 298.18 g/mol. IUPAC name: tert-butyl 4-bromo-2,3-dihydroindole-1-carboxylate. InChIKey: DUZIJTYKDFFQDJ-UHFFFAOYSA-N.
| Molecular formula | C13H16BrNO2 |
|---|---|
| Molecular weight | 298.18 g/mol |
| IUPAC name | tert-butyl 4-bromo-2,3-dihydroindole-1-carboxylate |
| InChIKey | DUZIJTYKDFFQDJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C1C=CC=C2Br |
Computed by PubChem (NCBI)