cas: 1250999-83-7 — see every product listed under this CAS number, including other names
tert-Butyl 5-(hydroxymethyl)-3,4-dihydro-2,7-naphthyridine-2(1H)-carboxylate, 98%, 98% (CAS 1250999-83-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HHYG-100mg |
| cas | 1250999-83-7 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 1562.00 Pln | |
| Chemat | 250mg | 2565.20 Pln | |
| Chemat | 1g | 5070.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 5-(hydroxymethyl)-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate (CAS 1250999-83-7) is a chemical compound with the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. IUPAC name: tert-butyl 5-(hydroxymethyl)-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate. InChIKey: GGPPXWMOQYWGJD-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O3 |
|---|---|
| Molecular weight | 264.32 g/mol |
| IUPAC name | tert-butyl 5-(hydroxymethyl)-3,4-dihydro-1H-2,7-naphthyridine-2-carboxylate |
| InChIKey | GGPPXWMOQYWGJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C=NC=C2C1)CO |
Computed by PubChem (NCBI)