cas: 1063734-19-9 — see every product listed under this CAS number, including other names
tert-Butyl 6-(hydroxymethyl)-1,4-oxazepane-4-carboxylate, 97% (CAS 1063734-19-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 500mg, 1g, 5g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A465044-10g |
| cas | 1063734-19-9 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 16878.82 Pln | |
| Fluorochem | 250mg | 1127.75 Pln | |
| Fluorochem | 500mg | 1580.71 Pln | |
| Fluorochem | 1g | 2226.32 Pln | |
| Fluorochem | 5g | 8682.38 Pln | |
| Fluorochem | 10g | 15560.16 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Tert-butyl 6-(hydroxymethyl)-1,4-oxazepane-4-carboxylate (CAS 1063734-19-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl 6-(hydroxymethyl)-1,4-oxazepane-4-carboxylate. InChIKey: SLJSFXUOECCLPA-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | tert-butyl 6-(hydroxymethyl)-1,4-oxazepane-4-carboxylate |
| InChIKey | SLJSFXUOECCLPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOCC(C1)CO |
Computed by PubChem (NCBI)