cas: 1063734-19-9 — see every product listed under this CAS number, including other names
tert-butyl 6-(hydroxymethyl)-1,4-oxazepane-4-carboxylate, 97%, 97% (CAS 1063734-19-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HAT1-250mg |
| cas | 1063734-19-9 |
| size | 250mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 500mg | 971.60 Pln | |
| Chemat | 1g | 1360.40 Pln | |
| Chemat | 5g | 5258.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 6-(hydroxymethyl)-1,4-oxazepane-4-carboxylate (CAS 1063734-19-9) is a chemical compound with the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. IUPAC name: tert-butyl 6-(hydroxymethyl)-1,4-oxazepane-4-carboxylate. InChIKey: SLJSFXUOECCLPA-UHFFFAOYSA-N.
| Molecular formula | C11H21NO4 |
|---|---|
| Molecular weight | 231.29 g/mol |
| IUPAC name | tert-butyl 6-(hydroxymethyl)-1,4-oxazepane-4-carboxylate |
| InChIKey | SLJSFXUOECCLPA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCOCC(C1)CO |
Computed by PubChem (NCBI)