cas: 2641906-15-0 — see every product listed under this CAS number, including other names
tert-butyl 3-(2-ethoxy-2-oxo-ethyl)-3-methyl-azetidine-1-carboxylate, 97% (CAS 2641906-15-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch135TKX-100mg |
| cas | 2641906-15-0 |
| size | 100mg |
| availability | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 731.60 Pln | |
| Chemat | 250mg | 1182.80 Pln | |
| Chemat | 500mg | 1634.00 Pln | |
| Chemat | 1g | 2306.00 Pln | |
| Chemat | 5g | 6789.20 Pln | |
| Fluorochem | 100mg | 1351.62 Pln | |
| Fluorochem | 250mg | 2184.66 Pln | |
| Fluorochem | 500mg | 3038.53 Pln | |
| Fluorochem | 1g | 4267.27 Pln | |
| Fluorochem | 5g | 12389.41 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl 3-(2-ethoxy-2-oxoethyl)-3-methylazetidine-1-carboxylate (CAS 2641906-15-0) is a chemical compound with the molecular formula C13H23NO4 and a molecular weight of 257.33 g/mol. IUPAC name: tert-butyl 3-(2-ethoxy-2-oxoethyl)-3-methylazetidine-1-carboxylate. InChIKey: PRCPNRFROCZYPG-UHFFFAOYSA-N.
| Molecular formula | C13H23NO4 |
|---|---|
| Molecular weight | 257.33 g/mol |
| IUPAC name | tert-butyl 3-(2-ethoxy-2-oxoethyl)-3-methylazetidine-1-carboxylate |
| InChIKey | PRCPNRFROCZYPG-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1(CN(C1)C(=O)OC(C)(C)C)C |
Computed by PubChem (NCBI)