cas: 131844-46-7 — see every product listed under this CAS number, including other names
trans-2-(3-Chlorophenyl)cyclopropanamine Hydrochloride, 95%, 95% (CAS 131844-46-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120DYC-100mg |
| cas | 131844-46-7 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 578.00 Pln | |
| Chemat | 250mg | 1134.80 Pln | |
| Chemat | 1g | 1475.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Trans-(1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride (CAS 131844-46-7) is a chemical compound with the molecular formula C9H11Cl2N and a molecular weight of 204.09 g/mol. IUPAC name: trans-(1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride. InChIKey: QRDJNIKTHWYMIN-OULXEKPRSA-N.
| Molecular formula | C9H11Cl2N |
|---|---|
| Molecular weight | 204.09 g/mol |
| IUPAC name | trans-(1R,2S)-2-(3-chlorophenyl)cyclopropan-1-amine;hydrochloride |
| InChIKey | QRDJNIKTHWYMIN-OULXEKPRSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=CC=C2)Cl.Cl |
Computed by PubChem (NCBI)